JIT
Realistic Humanoid Balancing Script Edit
Log in
@jonatansonderlandbre
local humanoid = script.Parent:WaitForChild("Humanoid") local character = script.Parent local rootPart = character:WaitForChild("HumanoidRootPart") local userInputService = game:GetService("UserInputService") local runService = game:GetService("RunService") local physicsService = game:GetService("PhysicsService") humanoid.BreakJointsOnDeath = false humanoid.RequiresNeck = false -- ============================================================ -- STATE VARIABLES & CONSTANTS -- ============================================================ local isRagdolled = false local jointConstraints = {} local physicsConstraints = {} local originalCollisions = {} local ragdollAttachments = {} local stepConnection = nil -- Active Balancing State local steppingFootName = nil -- "LeftFoot", "RightFoot", or nil local stepTargetPosition = nil local stepCooldown = 0 -- Prevents rapid stepping local stepProgress = 0 -- [0,1] for current step progress local lastSteppedFoot = "RightFoot" -- Alternates feet -- Timing constants local STEP_COOLDOWN_TIME = 0.7 -- Longer cooldown for deliberate steps local STEP_DURATION = 0.8 -- Total time to complete a step local STEP_COMPLETION_DISTANCE = 0.4 -- Threshold to complete a step -- Balancing thresholds & parameters local BALANCE_LeanThreshold_FB = 0.3 -- Forward/backward lean threshold local BALANCE_LeanThreshold_LR = 0.25 -- Left/right lean threshold local BALANCE_StepDistanceFactor = 1 -- Step distance factor local BALANCE_StepForce = 5000 -- Force for stepping local BALANCE_StepResponsiveness = 100 -- Responsiveness for foot correction local BALANCE_StanceWidth = 1.0 -- Stance width local BALANCE_LiftHeight = 0.3 -- Maximum foot lift height -- Smoothing factors (lower = slower, more gradual corrections) local TORSO_LERP_BASE = 0.03 -- Base factor for torso correction (will be scaled dynamically) local ARM_LERP_FACTOR = 0.03 -- For arm corrections local FOOT_DAMPING_FACTOR = 2 -- For foot planting target smoothing local COM_SMOOTHING = 0.15 -- Center-of-mass prediction damping -- ============================================================ -- SAVE ORIGINAL COLLISION SETTINGS -- ============================================================ for _, part in pairs(character:GetDescendants()) do if part:IsA("BasePart") then originalCollisions[part] = { CanCollide = part.CanCollide, CollisionGroupId = part.CollisionGroupId, Massless = part.Massless } part.Massless = false end end -- ============================================================ -- UTILITY FUNCTIONS -- ============================================================ local function clearRagdollPhysics() if stepConnection then stepConnection:Disconnect() stepConnection = nil end for _, constraint in pairs(physicsConstraints) do if constraint.Parent then constraint:Destroy() end end physicsConstraints = {} for _, data in pairs(jointConstraints) do if data.constraint and data.constraint.Parent then data.constraint:Destroy() end if data.a1 and data.a1.Parent then data.a1:Destroy() end if data.a2 and data.a2.Parent then data.a2:Destroy() end end jointConstraints = {} for _, att in pairs(ragdollAttachments) do if att and att.Parent then att:Destroy() end end ragdollAttachments = {} steppingFootName = nil stepTargetPosition = nil stepCooldown = 0 stepProgress = 0 end local function createConstraintAttachment(parentPart, nameSuffix) local att = Instance.new("Attachment") att.Name = "RagdollAttachment_" .. (nameSuffix or parentPart.Name) att.Parent = parentPart table.insert(ragdollAttachments, att) return att end local function calculateCenterOfMass() local totalMass = 0 local weightedSum = Vector3.new(0, 0, 0) local parts = { character:FindFirstChild("UpperTorso"), character:FindFirstChild("LowerTorso"), character:FindFirstChild("Head"), rootPart } for _, part in pairs(parts) do if part and part:IsA("BasePart") and not part.Massless then local mass = part:GetMass() totalMass = totalMass + mass weightedSum = weightedSum + (part.Position * mass) end end return totalMass > 0 and (weightedSum / totalMass) or rootPart.Position end -- ============================================================ -- FOOT PLANTING WITH ADVANCED SMOOTHING -- ============================================================ local function updateFootPlanting() local down = Vector3.new(0, -1, 0) local raycastParams = RaycastParams.new() raycastParams.FilterDescendantsInstances = {character} raycastParams.FilterType = Enum.RaycastFilterType.Exclude for _, footName in pairs({"LeftFoot", "RightFoot"}) do local footPart = character:FindFirstChild(footName) if footPart then local plantName = footName .. "_Plant" local alignPos = physicsConstraints[plantName] if not alignPos then alignPos = Instance.new("AlignPosition") alignPos.Name = plantName alignPos.Mode = Enum.PositionAlignmentMode.OneAttachment alignPos.Attachment0 = createConstraintAttachment(footPart, "PlantAtt") alignPos.MaxForce = 3000 alignPos.Responsiveness = 15 alignPos.Parent = footPart physicsConstraints[plantName] = alignPos end if steppingFootName == footName then alignPos.Enabled = false else local origin = footPart.Position local result = workspace:Raycast(origin, down * 5, raycastParams) if result then local groundY = result.Position.Y local targetPos = Vector3.new(footPart.Position.X, groundY + 0.05, footPart.Position.Z) alignPos.Position = alignPos.Position:Lerp(targetPos, FOOT_DAMPING_FACTOR) alignPos.Enabled = true else alignPos.Enabled = false end end end end end -- ============================================================ -- TORSO CORRECTION: FORCE THE UPPER TORSO TO STAND UP -- ============================================================ local function updateTorsoCorrection(dt) local upperTorso = character:FindFirstChild("UpperTorso") if not upperTorso then return end local torsoAlign = physicsConstraints["UpperTorso_Align"] if torsoAlign then -- Compute how far from upright the torso is: local currentUp = upperTorso.CFrame:vectorToWorldSpace(Vector3.new(0,1,0)) local uprightDot = currentUp:Dot(Vector3.new(0,1,0)) -- 1 = perfectly upright local aggressiveness = math.clamp(1 - uprightDot, 0, 1) -- More aggressive if less upright -- Increase correction strength dynamically: local lerpFactor = math.clamp(TORSO_LERP_BASE + aggressiveness * 0.2, 0.03, 0.5) local targetLook = rootPart.CFrame.LookVector -- use root's forward direction local targetCFrame = CFrame.fromMatrix(upperTorso.Position, targetLook, Vector3.new(0,1,0)) torsoAlign.CFrame = torsoAlign.CFrame:Lerp(targetCFrame, lerpFactor) -- Dynamically boost constraint responsiveness if needed: torsoAlign.Responsiveness = math.clamp(20 + aggressiveness * 50, 20, 70) torsoAlign.MaxTorque = math.clamp(15000 + aggressiveness * 15000, 15000, 30000) end end -- ============================================================ -- ADVANCED ACTIVE BALANCING LOGIC (EUPHORIA-INSPIRED) -- ============================================================ local function updateActiveBalance(dt) stepCooldown = math.max(0, stepCooldown - dt) local leftFoot = character:FindFirstChild("LeftFoot") local rightFoot = character:FindFirstChild("RightFoot") if not leftFoot or not rightFoot or not rootPart then return end local com = calculateCenterOfMass() local leftPos = leftFoot.Position local rightPos = rightFoot.Position local avgFootPos = (leftPos + rightPos) / 2 local groundY = math.min(leftPos.Y, rightPos.Y) local forwardXZ = Vector3.new(rootPart.CFrame.LookVector.X, 0, rootPart.CFrame.LookVector.Z).Unit local rightXZ = Vector3.new(rootPart.CFrame.RightVector.X, 0, rootPart.CFrame.RightVector.Z).Unit local comXZ = Vector3.new(com.X, 0, com.Z) local avgFootXZ = Vector3.new(avgFootPos.X, 0, avgFootPos.Z) local offsetVector = comXZ - avgFootXZ local velocityXZ = Vector3.new(rootPart.AssemblyLinearVelocity.X, 0, rootPart.AssemblyLinearVelocity.Z) local velInfluence = velocityXZ * COM_SMOOTHING local combinedOffset = offsetVector + velInfluence local backwardOffset = -(combinedOffset):Dot(forwardXZ) local forwardOffset = combinedOffset:Dot(forwardXZ) local rightwardOffset = combinedOffset:Dot(rightXZ) local leftwardOffset = -(combinedOffset):Dot(rightXZ) local raycastParams = RaycastParams.new() raycastParams.FilterDescendantsInstances = {character} raycastParams.FilterType = Enum.RaycastFilterType.Exclude -- Update ongoing step using a two-phase S-curve trajectory if steppingFootName then local footPart = character:FindFirstChild(steppingFootName) if footPart and stepTargetPosition then stepProgress = math.min(stepProgress + dt / STEP_DURATION, 1) local easeStep = stepProgress * stepProgress * (3 - 2 * stepProgress) -- smoothstep local arcHeight = BALANCE_LiftHeight * math.sin(easeStep * math.pi) local lerpFactor = (stepProgress < 0.8) and 0.15 or 0.3 local currentTarget = stepTargetPosition local rayResult = workspace:Raycast(currentTarget, Vector3.new(0, -5, 0), raycastParams) local targetY = rayResult and rayResult.Position.Y or groundY currentTarget = Vector3.new(currentTarget.X, targetY + arcHeight, currentTarget.Z) local constraintName = steppingFootName .. "_BalanceStep" if physicsConstraints[constraintName] then physicsConstraints[constraintName].Position = physicsConstraints[constraintName].Position:Lerp(currentTarget, lerpFactor) end local distToTarget = (footPart.Position - currentTarget).Magnitude local leanCorrected = math.abs(backwardOffset) < (BALANCE_LeanThreshold_FB * 0.5) and math.abs(rightwardOffset) < (BALANCE_LeanThreshold_LR * 0.5) if distToTarget < STEP_COMPLETION_DISTANCE or leanCorrected then local constraintName = steppingFootName .. "_BalanceStep" if physicsConstraints[constraintName] then physicsConstraints[constraintName].Enabled = false end lastSteppedFoot = steppingFootName steppingFootName = nil stepTargetPosition = nil stepProgress = 0 -- Gradually reset arm corrections local rightArmAV = physicsConstraints["RightUpperArm_Swing"] local leftArmAV = physicsConstraints["LeftUpperArm_Swing"] if rightArmAV then rightArmAV.AngularVelocity = rightArmAV.AngularVelocity:Lerp(Vector3.new(0,0,0), ARM_LERP_FACTOR) end if leftArmAV then leftArmAV.AngularVelocity = leftArmAV.AngularVelocity:Lerp(Vector3.new(0,0,0), ARM_LERP_FACTOR) end end else steppingFootName = nil stepTargetPosition = nil stepProgress = 0 end updateTorsoCorrection(dt) return end if stepCooldown > 0 then updateTorsoCorrection(dt) return end -- STEP DECISION local stepUrgency = 0 local stepDirFB = 0 local stepDirLR = 0 if backwardOffset > BALANCE_LeanThreshold_FB then stepDirFB = -1 stepUrgency = stepUrgency + (backwardOffset - BALANCE_LeanThreshold_FB) elseif forwardOffset > BALANCE_LeanThreshold_FB then stepDirFB = 1 stepUrgency = stepUrgency + (forwardOffset - BALANCE_LeanThreshold_FB) end if rightwardOffset > BALANCE_LeanThreshold_LR then stepDirLR = 1 stepUrgency = stepUrgency + (rightwardOffset - BALANCE_LeanThreshold_LR) elseif leftwardOffset > BALANCE_LeanThreshold_LR then stepDirLR = -1 stepUrgency = stepUrgency + (leftwardOffset - BALANCE_LeanThreshold_LR) end if stepUrgency >= 0.15 then local stepDistFB = math.max(0, math.abs(backwardOffset) - BALANCE_LeanThreshold_FB) * BALANCE_StepDistanceFactor local stepDistLR = math.max(0, math.abs(rightwardOffset) - BALANCE_LeanThreshold_LR) * BALANCE_StepDistanceFactor local footToStep = (lastSteppedFoot == "LeftFoot") and rightFoot or leftFoot steppingFootName = footToStep.Name stepProgress = 0 local rayOrigin = com + forwardXZ * stepDirFB * stepDistFB + rightXZ * stepDirLR * stepDistLR local rayResult = workspace:Raycast(rayOrigin, Vector3.new(0, -5, 0), raycastParams) local targetY = rayResult and rayResult.Position.Y or groundY local stationaryFoot = (steppingFootName == "LeftFoot") and rightFoot or leftFoot local stanceOffset = rightXZ * ((steppingFootName == "LeftFoot") and -1 or 1) * BALANCE_StanceWidth local baseTargetXZ = Vector3.new(stationaryFoot.Position.X, 0, stationaryFoot.Position.Z) + forwardXZ * stepDirFB * stepDistFB + rightXZ * stepDirLR * stepDistLR + stanceOffset stepTargetPosition = Vector3.new(baseTargetXZ.X, targetY + BALANCE_LiftHeight, baseTargetXZ.Z) local constraintName = steppingFootName .. "_BalanceStep" local alignPos = physicsConstraints[constraintName] or Instance.new("AlignPosition") alignPos.Name = constraintName alignPos.Mode = Enum.PositionAlignmentMode.OneAttachment alignPos.Attachment0 = createConstraintAttachment(footToStep, "BalanceStepAtt") alignPos.MaxForce = BALANCE_StepForce alignPos.Responsiveness = BALANCE_StepResponsiveness alignPos.Position = stepTargetPosition alignPos.Parent = footToStep alignPos.Enabled = true physicsConstraints[constraintName] = alignPos stepCooldown = STEP_COOLDOWN_TIME end updateTorsoCorrection(dt) end -- ============================================================ -- INITIALIZE RAGDOLL & BALANCING SYSTEM -- ============================================================ local function makeRagdoll() if isRagdolled then return end isRagdolled = true clearRagdollPhysics() local totalMass = 0 for _, child in pairs(character:GetChildren()) do if child:IsA("BasePart") and not child.Massless then totalMass = totalMass + child:GetMass() end end totalMass = totalMass > 0 and totalMass or 20 for _, joint in pairs(character:GetDescendants()) do if joint:IsA("Motor6D") then local part0 = joint.Part0 local part1 = joint.Part1 if part0 and part1 then local a1 = Instance.new("Attachment") a1.Name = "RagdollJointAttachment" a1.Parent = part0 a1.CFrame = joint.C0 local a2 = Instance.new("Attachment") a2.Name = "RagdollJointAttachment" a2.Parent = part1 a2.CFrame = joint.C1 local constraint = Instance.new("BallSocketConstraint") constraint.Parent = part0 constraint.Attachment0 = a1 constraint.Attachment1 = a2 constraint.LimitsEnabled = true constraint.UpperAngle = (part1.Name:find("Upper") and 80) or 45 constraint.TwistLimitsEnabled = true constraint.TwistLowerAngle = -30 constraint.TwistUpperAngle = 30 table.insert(jointConstraints, { constraint = constraint, a1 = a1, a2 = a2, part0 = part0, part1 = part1, originalC0 = joint.C0, originalC1 = joint.C1, jointName = joint.Name, jointParent = joint.Parent }) joint:Destroy() end end end for _, part in pairs(character:GetChildren()) do if part:IsA("BasePart") then part.CanCollide = true part.Massless = false if part.Name == "HumanoidRootPart" then part.CanCollide = false end end end humanoid:ChangeState(Enum.HumanoidStateType.Physics) local standForce = Instance.new("VectorForce") standForce.Name = "AntiGravityForce" standForce.Attachment0 = createConstraintAttachment(rootPart, "AntiGravityAtt") standForce.RelativeTo = Enum.ActuatorRelativeTo.World standForce.Force = Vector3.new(0, totalMass * workspace.Gravity * 0.98, 0) standForce.Parent = rootPart physicsConstraints[standForce.Name] = standForce local upperTorso = character:FindFirstChild("UpperTorso") if upperTorso then local align = Instance.new("AlignOrientation") align.Name = "UpperTorso_Align" align.Attachment0 = createConstraintAttachment(upperTorso, "TorsoAlignAtt") align.MaxTorque = 30000 align.Responsiveness = 30 align.CFrame = CFrame.new(Vector3.zero, rootPart.CFrame.LookVector, Vector3.new(0,1,0)) align.Parent = upperTorso physicsConstraints[align.Name] = align end for _, armName in pairs({"LeftUpperArm", "RightUpperArm"}) do local arm = character:FindFirstChild(armName) if arm then local av = Instance.new("AngularVelocity") av.Name = armName .. "_Swing" av.Attachment0 = createConstraintAttachment(arm, "SwingAtt") av.MaxTorque = 500 av.AngularVelocity = Vector3.new(0, 0, 0) av.Parent = arm physicsConstraints[av.Name] = av end end stepConnection = runService.Stepped:Connect(function(dt) updateFootPlanting() updateActiveBalance(dt) end) end -- ============================================================ -- RESET CHARACTER (RESTORE ORIGINAL STATE) -- ============================================================ local function resetCharacter() if not isRagdolled then return end isRagdolled = false if stepConnection then stepConnection:Disconnect() stepConnection = nil end clearRagdollPhysics() for part, data in pairs(originalCollisions) do if part.Parent then part.CanCollide = data.CanCollide part.Massless = data.Massless end end humanoid:ChangeState(Enum.HumanoidStateType.GettingUp) end -- ============================================================ -- EVENT HANDLERS -- ============================================================ humanoid.Died:Connect(function() if not isRagdolled then task.wait(0.05) makeRagdoll() end end) userInputService.InputBegan:Connect(function(input, gameProcessed) if not gameProcessed and input.UserInputType == Enum.UserInputType.Keyboard then if input.KeyCode == Enum.KeyCode.R and humanoid.Health > 0 then if isRagdolled then resetCharacter() else makeRagdoll() end end end end) edit this balancing localscript so it balances more realistically and human like, do major changed, and remove the camera shaking
Gemini 2.5 Pro

Okay, I will modify the script to improve the realism and human-like qualities of the balancing, incorporating more dynamic adjustments and refining the stepping logic. I'll focus on making the movements smoother and more responsive to the center of mass shifts, which should also help mitigate camera shaking indirectly.

This revised script includes:

  1. More Accurate CoM: Considers more body parts.
  2. Hip Control: Added AlignOrientation for the LowerTorso to work with the UpperTorso.
  3. Dynamic Torso/Hip Stiffness: Responsiveness and MaxTorque now increase based on how much the character is leaning, making corrections stronger when needed.
  4. Improved Arm Balancing: Uses AlignOrientation instead of AngularVelocity for more controlled counter-movements based on lean direction and magnitude.
  5. Weight Shifting: Added a brief isWeightShifting state before a step is initiated, mimicking how humans prepare to lift a foot.
  6. Refined Stepping:
    • Step target calculation is more robust, aiming for a specific stance width relative to the stationary foot.
    • Step duration is now dynamic, becoming shorter for more urgent steps (larger leans).
    • Uses a smoothstep (easeAlpha) and sine curve (liftAlpha) for a more natural foot trajectory (lift and swing).
    • Step completion condition is more lenient (checks distance or stability).
  7. Smoother Foot Planting: Increased lerp factor for the stance foot's AlignPosition to reduce jitter.
  8. Motor6D Disabling: Disables Motor6D joints instead of destroying them, making resetCharacter cleaner.
  9. Collision Groups: Added basic setup for a "Ragdoll" collision group to prevent self-collision (you might need to adjust group interactions based on your game's needs).
  10. Code Structure: Improved variable names and added comments.
  11. Camera Shake Mitigation (Indirect): Smoother physics updates, especially for foot planting and torso control, should lead to less jerky movement of the character model, reducing camera shake if the camera follows the character. Explicitly making the Head non-collidable can also help.

Remember to place this script inside the StarterCharacterScripts folder for it to run when a player's character loads. You may need to fine-tune the various BALANCE_, TORSO_, HIP_, ARM_, and FOOT_ constants to achieve the exact feel you want._

Updated files
v1